CAS 1884712-47-3 appears in our catalog under these names: CPI–637, CPI-637/ 99.91% (existing batch purity), CPI-637, CPI-637, 98+%, 98+%, CPI-637, 99.94%. Offered by: GLPBio, TargetMol, Biosynth, Chemat, MedChemExpress. Available pack sizes: 10mg, 50mg, 1mg, 2mg, 5mg, 25mg, 100mg, 500mg.
(4R)-4-methyl-6-[1-methyl-3-(1-methylpyrazol-4-yl)indazol-5-yl]-1,3,4,5-tetrahydro-1,5-benzodiazepin-2-one (CAS 1884712-47-3) is a chemical compound with the molecular formula C22H22N6O and a molecular weight of 386.4 g/mol. IUPAC name: (4R)-4-methyl-6-[1-methyl-3-(1-methylpyrazol-4-yl)indazol-5-yl]-1,3,4,5-tetrahydro-1,5-benzodiazepin-2-one. InChIKey: BFTKDWYIRJGJCA-CYBMUJFWSA-N.
| Molecular formula | C22H22N6O |
|---|---|
| Molecular weight | 386.4 g/mol |
| IUPAC name | (4R)-4-methyl-6-[1-methyl-3-(1-methylpyrazol-4-yl)indazol-5-yl]-1,3,4,5-tetrahydro-1,5-benzodiazepin-2-one |
| InChIKey | BFTKDWYIRJGJCA-CYBMUJFWSA-N |
| SMILES | C[C@@H]1CC(=O)NC2=CC=CC(=C2N1)C3=CC4=C(C=C3)N(N=C4C5=CN(N=C5)C)C |
Computed by PubChem (NCBI)