CAS 141282-35-1 appears in our catalog under these names: Amino-peg5-ch2co2h, 98%, Amino–PEG5–CH2COOH, Amino-PEG5-CH2COOH 98%, 17-Amino-3,6,9,12,15-pentaoxaheptadecanoic acid, 97%, 97%, Amino-PEG5-CH2COOH, 97.0%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, MedChemExpress. Available pack sizes: 1g, 250mg, 100mg, 50mg, 5g, 10g, 100 mg, 50 mg.
2-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]acetic acid (CAS 141282-35-1) is a chemical compound with the molecular formula C12H25NO7 and a molecular weight of 295.33 g/mol. IUPAC name: 2-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]acetic acid. InChIKey: ZQGSSZVORHCAFC-UHFFFAOYSA-N.
| Molecular formula | C12H25NO7 |
|---|---|
| Molecular weight | 295.33 g/mol |
| IUPAC name | 2-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]acetic acid |
| InChIKey | ZQGSSZVORHCAFC-UHFFFAOYSA-N |
| SMILES | C(COCCOCCOCCOCCOCC(=O)O)N |
Computed by PubChem (NCBI)