Products 91681-94-6

CAS 91681-94-6 is the registry number for Pregabalin Impurity 193. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

(2S)-4-methyl-2-[[(2R,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]amino]pentanoic acid (CAS 91681-94-6) is a chemical compound with the molecular formula C12H25NO7 and a molecular weight of 295.33 g/mol. IUPAC name: (2S)-4-methyl-2-[[(2R,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]amino]pentanoic acid. InChIKey: WNIGFKPNWAORFG-VPJKUYQRSA-N.

Identity
Molecular formulaC12H25NO7
Molecular weight295.33 g/mol
IUPAC name(2S)-4-methyl-2-[[(2R,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]amino]pentanoic acid
InChIKeyWNIGFKPNWAORFG-VPJKUYQRSA-N
SMILESCC(C)C[C@@H](C(=O)O)NC[C@H]([C@H]([C@@H]([C@@H](CO)O)O)O)O

Computed by PubChem (NCBI)