CAS 14131-68-1 is the registry number for N-Acetyl-β-D-glucosamine. Offered by: Biosynth. Available pack sizes: 0,1g, 0,05g, 0,25g, 0,5g, 1g.
Chitin is an aminoglycan consisting of beta-(14)-linked N-acetyl-D-glucosamine residues. It has a role as a vulnerary, a mouse metabolite, a Saccharomyces cerevisiae metabolite and a human metabolite. It is a N-acylglucosamine and an aminoglycan.
Source: ChEBI
| Molecular formula | C8H15NO6 |
|---|---|
| Molecular weight | 221.21 g/mol |
| IUPAC name | N-[(2R,3R,4R,5S,6R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]acetamide |
| InChIKey | OVRNDRQMDRJTHS-FMDGEEDCSA-N |
| SMILES | CC(=O)N[C@@H]1[C@H]([C@@H]([C@H](O[C@H]1O)CO)O)O |
Computed by PubChem (NCBI)