CAS 14132-51-5 appears in our catalog under these names: Benzaldehyde-d5, >95% (GC), Benzaldehyde-2,3,4,5,6-d5, 99 atom % D, min 96% Chemical Purity, Benzaldehyde–2,3,4,5,6–d5, Benzaldehyde D5, BENZALDEHYDE-2,3,4,5,6-D5, 99 ATOM % D. Offered by: TRC, CDN, GLPBio, Biosynth, Sigma-Aldrich. Available pack sizes: 100mg, 1g, 250mg, 5g, 500mg, 1000mg, 2000mg, 5000mg.
2,3,4,5,6-pentadeuteriobenzaldehyde (CAS 14132-51-5) is a chemical compound with the molecular formula C7H6O and a molecular weight of 111.15 g/mol. IUPAC name: 2,3,4,5,6-pentadeuteriobenzaldehyde. InChIKey: HUMNYLRZRPPJDN-RALIUCGRSA-N.
| Molecular formula | C7H6O |
|---|---|
| Molecular weight | 111.15 g/mol |
| IUPAC name | 2,3,4,5,6-pentadeuteriobenzaldehyde |
| InChIKey | HUMNYLRZRPPJDN-RALIUCGRSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])C=O)[2H])[2H] |
Computed by PubChem (NCBI)