CAS 17901-93-8 appears in our catalog under these names: Benzaldehyde-d6, Benzaldehyde-d6, 98 atom % D, min 96% Chemical Purity, Benzaldehyde–d6, BENZALDEHYDE-D6, 98 ATOM % D, D6-Benzaldehyde. Offered by: TRC, CDN, GLPBio, Biosynth, Sigma-Aldrich. Available pack sizes: 0,2mg, 0,4mg, 2mg, 5g, 1g, 0,5g, 2g, 10g.
Deuterio-(2,3,4,5,6-pentadeuteriophenyl)methanone (CAS 17901-93-8) is a chemical compound with the molecular formula C7H6O and a molecular weight of 112.16 g/mol. IUPAC name: deuterio-(2,3,4,5,6-pentadeuteriophenyl)methanone. InChIKey: HUMNYLRZRPPJDN-MZWXYZOWSA-N.
| Molecular formula | C7H6O |
|---|---|
| Molecular weight | 112.16 g/mol |
| IUPAC name | deuterio-(2,3,4,5,6-pentadeuteriophenyl)methanone |
| InChIKey | HUMNYLRZRPPJDN-MZWXYZOWSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])C(=O)[2H])[2H])[2H] |
Computed by PubChem (NCBI)