CAS 1413376-86-9 is the registry number for 2-Chloro-4-(naphthalen-1-yl)quinazoline, 95%, 95%. Offered by: Chemat. Available pack sizes: 250mg, 1g.
2-chloro-4-naphthalen-1-ylquinazoline (CAS 1413376-86-9) is a chemical compound with the molecular formula C18H11ClN2 and a molecular weight of 290.7 g/mol. IUPAC name: 2-chloro-4-naphthalen-1-ylquinazoline. InChIKey: QYBNYPQRKRMMNX-UHFFFAOYSA-N.
| Molecular formula | C18H11ClN2 |
|---|---|
| Molecular weight | 290.7 g/mol |
| IUPAC name | 2-chloro-4-naphthalen-1-ylquinazoline |
| InChIKey | QYBNYPQRKRMMNX-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC=C2C3=NC(=NC4=CC=CC=C43)Cl |
Computed by PubChem (NCBI)