CAS 1937210-90-6 appears in our catalog under these names: 2-Chloro-9-phenyl-1,10-phenanthroline, >98.0%(HPLC)(T), 2-Chloro-9-phenyl-1,10-phenanthroline, 98%, 98%, 2-Chloro-9-phenyl-1,10-phenanthroline, 98%. Offered by: TCI, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 10g, 25g.
2-chloro-9-phenyl-1,10-phenanthroline (CAS 1937210-90-6) is a chemical compound with the molecular formula C18H11ClN2 and a molecular weight of 290.7 g/mol. IUPAC name: 2-chloro-9-phenyl-1,10-phenanthroline. InChIKey: OLEBEWHIVDADAL-UHFFFAOYSA-N.
| Molecular formula | C18H11ClN2 |
|---|---|
| Molecular weight | 290.7 g/mol |
| IUPAC name | 2-chloro-9-phenyl-1,10-phenanthroline |
| InChIKey | OLEBEWHIVDADAL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC3=C(C=CC4=C3N=C(C=C4)Cl)C=C2 |
Computed by PubChem (NCBI)