CAS 14135-63-8 is the registry number for 2-Phenyl-2,3-dihydropyridazin-3-one. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
2-phenylpyridazin-3-one (CAS 14135-63-8) is a chemical compound with the molecular formula C10H8N2O and a molecular weight of 172.18 g/mol. IUPAC name: 2-phenylpyridazin-3-one. InChIKey: BFOMTEBFEFQJHY-UHFFFAOYSA-N.
| Molecular formula | C10H8N2O |
|---|---|
| Molecular weight | 172.18 g/mol |
| IUPAC name | 2-phenylpyridazin-3-one |
| InChIKey | BFOMTEBFEFQJHY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C(=O)C=CC=N2 |
Computed by PubChem (NCBI)