CAS 141394-11-8 is the registry number for Luliconazole Impurity 15. Offered by: Chemat Brand. Available pack sizes: on request.
(2S)-2-(2,4-dichlorophenyl)oxirane (CAS 141394-11-8) is a chemical compound with the molecular formula C8H6Cl2O and a molecular weight of 189.04 g/mol. IUPAC name: (2S)-2-(2,4-dichlorophenyl)oxirane. InChIKey: ZRMLHFOKDLDAIB-MRVPVSSYSA-N.
| Molecular formula | C8H6Cl2O |
|---|---|
| Molecular weight | 189.04 g/mol |
| IUPAC name | (2S)-2-(2,4-dichlorophenyl)oxirane |
| InChIKey | ZRMLHFOKDLDAIB-MRVPVSSYSA-N |
| SMILES | C1[C@@H](O1)C2=C(C=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)