CAS 1414348-94-9 is the registry number for (2R,3S)-2-((tert-Butoxycarbonyl)amino)-4,4,4-trifluoro-3-methylbutanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2R,3S)-4,4,4-trifluoro-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid (CAS 1414348-94-9) is a chemical compound with the molecular formula C10H16F3NO4 and a molecular weight of 271.23 g/mol. IUPAC name: (2R,3S)-4,4,4-trifluoro-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid. InChIKey: URADCGNNXPUQAP-NTSWFWBYSA-N.
| Molecular formula | C10H16F3NO4 |
|---|---|
| Molecular weight | 271.23 g/mol |
| IUPAC name | (2R,3S)-4,4,4-trifluoro-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid |
| InChIKey | URADCGNNXPUQAP-NTSWFWBYSA-N |
| SMILES | C[C@@H]([C@H](C(=O)O)NC(=O)OC(C)(C)C)C(F)(F)F |
Computed by PubChem (NCBI)