CAS 2050910-08-0 is the registry number for 2-((tert-Butoxycarbonyl)(methyl)amino)-4,4,4-trifluorobutanoic acid, 97%. Offered by: AmBeed. Available pack sizes: 5g, 1g.
4,4,4-trifluoro-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]butanoic acid (CAS 2050910-08-0) is a chemical compound with the molecular formula C10H16F3NO4 and a molecular weight of 271.23 g/mol. IUPAC name: 4,4,4-trifluoro-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]butanoic acid. InChIKey: FTMMRODRMJIILF-UHFFFAOYSA-N.
| Molecular formula | C10H16F3NO4 |
|---|---|
| Molecular weight | 271.23 g/mol |
| IUPAC name | 4,4,4-trifluoro-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]butanoic acid |
| InChIKey | FTMMRODRMJIILF-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N(C)C(CC(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)