CAS 141450-48-8 appears in our catalog under these names: N-(2-((4-Hydroxyphenyl)amino)pyridin-3-yl)-4-methoxybenzenesulfonamide hydrochloride, 98%, Abt-751 hydrochloride, E-7010 monohydrochloride, ABT-751 (hydrochloride). Offered by: Chemat Brand, Biosynth, Chemat, MedChemExpress. Available pack sizes: on request, 25mg, 50mg, 100mg, 5mg, Get quote.
N-[2-(4-hydroxyanilino)-3-pyridinyl]-4-methoxybenzenesulfonamide;hydrochloride (CAS 141450-48-8) is a chemical compound with the molecular formula C18H18ClN3O4S and a molecular weight of 407.9 g/mol. IUPAC name: N-[2-(4-hydroxyanilino)-3-pyridinyl]-4-methoxybenzenesulfonamide;hydrochloride. InChIKey: KWQWWUXRGIIBAS-UHFFFAOYSA-N.
| Molecular formula | C18H18ClN3O4S |
|---|---|
| Molecular weight | 407.9 g/mol |
| IUPAC name | N-[2-(4-hydroxyanilino)-3-pyridinyl]-4-methoxybenzenesulfonamide;hydrochloride |
| InChIKey | KWQWWUXRGIIBAS-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)S(=O)(=O)NC2=C(N=CC=C2)NC3=CC=C(C=C3)O.Cl |
Computed by PubChem (NCBI)