Products 1448452-22-9
CAS 1448452-22-9 is the registry number for TP receptor antagonist-2. Offered by: MedChemExpress. Available pack sizes: Get quote.
1-tert-butyl-3-[2-(4-chlorophenoxy)-5-cyanophenyl]sulfonylurea (CAS 1448452-22-9) is a chemical compound with the molecular formula C18H18ClN3O4S and a molecular weight of 407.9 g/mol. IUPAC name: 1-tert-butyl-3-[2-(4-chlorophenoxy)-5-cyanophenyl]sulfonylurea. InChIKey: BMNOHQHPZFGTJI-UHFFFAOYSA-N.
| Molecular formula | C18H18ClN3O4S |
|---|---|
| Molecular weight | 407.9 g/mol |
| IUPAC name | 1-tert-butyl-3-[2-(4-chlorophenoxy)-5-cyanophenyl]sulfonylurea |
| InChIKey | BMNOHQHPZFGTJI-UHFFFAOYSA-N |
| SMILES | CC(C)(C)NC(=O)NS(=O)(=O)C1=C(C=CC(=C1)C#N)OC2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)
Synonyms:
TP receptor antagonist-2, orb2565134