Products 141474-54-6
CAS 141474-54-6 appears in our catalog under these names: SDZ SER 082, SDZ SER 082 fumarate. Offered by: TRC, GLPBio. Available pack sizes: 500mg, 10mg, 50mg.
(E)-but-2-enedioic acid;(2R,7S)-4-methyl-4,9-diazatetracyclo[7.6.1.02,7.012,16]hexadeca-1(15),12(16),13-triene (CAS 141474-54-6) is a chemical compound with the molecular formula C19H24N2O4 and a molecular weight of 344.4 g/mol. IUPAC name: (E)-but-2-enedioic acid;(2R,7S)-4-methyl-4,9-diazatetracyclo[7.6.1.02,7.012,16]hexadeca-1(15),12(16),13-triene. InChIKey: DXUZZRDHJMOLTN-MRYVXRNOSA-N.
| Molecular formula | C19H24N2O4 |
|---|---|
| Molecular weight | 344.4 g/mol |
| IUPAC name | (E)-but-2-enedioic acid;(2R,7S)-4-methyl-4,9-diazatetracyclo[7.6.1.02,7.012,16]hexadeca-1(15),12(16),13-triene |
| InChIKey | DXUZZRDHJMOLTN-MRYVXRNOSA-N |
| SMILES | CN1CC[C@@H]2CN3CCC4=C3C(=CC=C4)[C@@H]2C1.C(=C/C(=O)O)\C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
SDZ SER 082 fumarate