CAS 1414837-14-1 is the registry number for trans-4-Phenyl-1-(2,2,2-trifluoroethyl)pyrrolidin-3-amine, 98+%. Offered by: Chemat Brand. Available pack sizes: on request.
(3S,4R)-4-phenyl-1-(2,2,2-trifluoroethyl)pyrrolidin-3-amine (CAS 1414837-14-1) is a chemical compound with the molecular formula C12H15F3N2 and a molecular weight of 244.26 g/mol. IUPAC name: (3S,4R)-4-phenyl-1-(2,2,2-trifluoroethyl)pyrrolidin-3-amine. InChIKey: MCSNMEVYCLODDS-WDEREUQCSA-N.
| Molecular formula | C12H15F3N2 |
|---|---|
| Molecular weight | 244.26 g/mol |
| IUPAC name | (3S,4R)-4-phenyl-1-(2,2,2-trifluoroethyl)pyrrolidin-3-amine |
| InChIKey | MCSNMEVYCLODDS-WDEREUQCSA-N |
| SMILES | C1[C@H]([C@@H](CN1CC(F)(F)F)N)C2=CC=CC=C2 |
Computed by PubChem (NCBI)