CAS 1496-40-8 appears in our catalog under these names: N-(2-Amino-4-trifluoromethylphenyl)piperidine, 95%, 2-(Piperidin-1-yl)-5-(trifluoromethyl)aniline, 95%, 95%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg.
2-piperidin-1-yl-5-(trifluoromethyl)aniline (CAS 1496-40-8) is a chemical compound with the molecular formula C12H15F3N2 and a molecular weight of 244.26 g/mol. IUPAC name: 2-piperidin-1-yl-5-(trifluoromethyl)aniline. InChIKey: BERRRZOJDANPHE-UHFFFAOYSA-N.
| Molecular formula | C12H15F3N2 |
|---|---|
| Molecular weight | 244.26 g/mol |
| IUPAC name | 2-piperidin-1-yl-5-(trifluoromethyl)aniline |
| InChIKey | BERRRZOJDANPHE-UHFFFAOYSA-N |
| SMILES | C1CCN(CC1)C2=C(C=C(C=C2)C(F)(F)F)N |
Computed by PubChem (NCBI)