Products 1414854-44-6
CAS 1414854-44-6 appears in our catalog under these names: Verosudil hydrochloride, Verosudil (hydrochloride). Offered by: TargetMol, MedChemExpress. Available pack sizes: 25mg, 50mg, 100mg, Get quote.
2-(dimethylamino)-N-(1-oxo-2H-isoquinolin-6-yl)-2-thiophen-3-ylacetamide;hydrochloride (CAS 1414854-44-6) is a chemical compound with the molecular formula C17H18ClN3O2S and a molecular weight of 363.9 g/mol. IUPAC name: 2-(dimethylamino)-N-(1-oxo-2H-isoquinolin-6-yl)-2-thiophen-3-ylacetamide;hydrochloride. InChIKey: FUBBJNODZIIYHW-UHFFFAOYSA-N.
| Molecular formula | C17H18ClN3O2S |
|---|---|
| Molecular weight | 363.9 g/mol |
| IUPAC name | 2-(dimethylamino)-N-(1-oxo-2H-isoquinolin-6-yl)-2-thiophen-3-ylacetamide;hydrochloride |
| InChIKey | FUBBJNODZIIYHW-UHFFFAOYSA-N |
| SMILES | CN(C)C(C1=CSC=C1)C(=O)NC2=CC3=C(C=C2)C(=O)NC=C3.Cl |
Computed by PubChem (NCBI)