CAS 2650810-07-2 appears in our catalog under these names: 2-Desfluoro Vonoprazan Hydrocloride, TAK438 Impurity 6 HCl. Offered by: TRC, Hubei YoungXin. Available pack sizes: 100mg, 10mg, 25mg, 50mg, 200mg.
N-methyl-1-(5-phenyl-1-pyridin-3-ylsulfonylpyrrol-3-yl)methanamine;hydrochloride (CAS 2650810-07-2) is a chemical compound with the molecular formula C17H18ClN3O2S and a molecular weight of 363.9 g/mol. IUPAC name: N-methyl-1-(5-phenyl-1-pyridin-3-ylsulfonylpyrrol-3-yl)methanamine;hydrochloride. InChIKey: UYDSPXBJDWPPEL-UHFFFAOYSA-N.
| Molecular formula | C17H18ClN3O2S |
|---|---|
| Molecular weight | 363.9 g/mol |
| IUPAC name | N-methyl-1-(5-phenyl-1-pyridin-3-ylsulfonylpyrrol-3-yl)methanamine;hydrochloride |
| InChIKey | UYDSPXBJDWPPEL-UHFFFAOYSA-N |
| SMILES | CNCC1=CN(C(=C1)C2=CC=CC=C2)S(=O)(=O)C3=CN=CC=C3.Cl |
Computed by PubChem (NCBI)