CAS 1414870-83-9 appears in our catalog under these names: 2,4-Bis(trifluoromethyl)-6-bromophenol, 95%, 2-Bromo-4,6-bis(trifluoromethyl)phenol, ≥95%, ≥95%, 2,4-Bis(trifluoromethyl)-6-bromophenol. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.
2-bromo-4,6-bis(trifluoromethyl)phenol (CAS 1414870-83-9) is a chemical compound with the molecular formula C8H3BrF6O and a molecular weight of 309.00 g/mol. IUPAC name: 2-bromo-4,6-bis(trifluoromethyl)phenol. InChIKey: FXBCIYDXVSFONE-UHFFFAOYSA-N.
| Molecular formula | C8H3BrF6O |
|---|---|
| Molecular weight | 309.00 g/mol |
| IUPAC name | 2-bromo-4,6-bis(trifluoromethyl)phenol |
| InChIKey | FXBCIYDXVSFONE-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C(F)(F)F)O)Br)C(F)(F)F |
Computed by PubChem (NCBI)