CAS 887268-16-8 appears in our catalog under these names: 2-Bromo-3,5-bis(trifluoromethyl)phenol, 95%, 2–Bromo–3,5–bis(trifluoromethyl)phenol. Offered by: Combi-blocks, GLPBio. Available pack sizes: 5g, 1g, 10g, 250mg.
2-bromo-3,5-bis(trifluoromethyl)phenol (CAS 887268-16-8) is a chemical compound with the molecular formula C8H3BrF6O and a molecular weight of 309.00 g/mol. IUPAC name: 2-bromo-3,5-bis(trifluoromethyl)phenol. InChIKey: VVNRKEGWEHWYQJ-UHFFFAOYSA-N.
| Molecular formula | C8H3BrF6O |
|---|---|
| Molecular weight | 309.00 g/mol |
| IUPAC name | 2-bromo-3,5-bis(trifluoromethyl)phenol |
| InChIKey | VVNRKEGWEHWYQJ-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C(F)(F)F)Br)O)C(F)(F)F |
Computed by PubChem (NCBI)