CAS 1414874-24-0 is the registry number for Fmoc-beta-Ala(2-F)-OH (R). Offered by: Iris Biotech. Available pack sizes: 1g, 5g.
(2R)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-2-fluoropropanoic acid (CAS 1414874-24-0) is a chemical compound with the molecular formula C18H16FNO4 and a molecular weight of 329.3 g/mol. IUPAC name: (2R)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-2-fluoropropanoic acid. InChIKey: KUUPJYSXGGJUDG-MRXNPFEDSA-N.
| Molecular formula | C18H16FNO4 |
|---|---|
| Molecular weight | 329.3 g/mol |
| IUPAC name | (2R)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-2-fluoropropanoic acid |
| InChIKey | KUUPJYSXGGJUDG-MRXNPFEDSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NC[C@H](C(=O)O)F |
Computed by PubChem (NCBI)