CAS 1651822-23-9 appears in our catalog under these names: (2R)-2-{((9H-fluoren-9-ylmethoxy)carbonyl)amino}-3-fluoropropanoic acid, 95%, (2R)-2-({((9H-Fluoren-9-yl)methoxy)carbonyl}amino)-3-fluoropropanoic acid, (2R)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-3-fluoropropanoic acid, 98%, 98%. Offered by: AmBeed, Biosynth, Chemat. Available pack sizes: 1g, 50mg, 0,5g, 5g.
(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-fluoropropanoic acid (CAS 1651822-23-9) is a chemical compound with the molecular formula C18H16FNO4 and a molecular weight of 329.3 g/mol. IUPAC name: (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-fluoropropanoic acid. InChIKey: KIPSDRHXCAHLLL-INIZCTEOSA-N.
| Molecular formula | C18H16FNO4 |
|---|---|
| Molecular weight | 329.3 g/mol |
| IUPAC name | (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-fluoropropanoic acid |
| InChIKey | KIPSDRHXCAHLLL-INIZCTEOSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@@H](CF)C(=O)O |
Computed by PubChem (NCBI)