CAS 1414933-89-3 is the registry number for tert-Butyl ((2S,4R,5R)-5-amino-4-hydroxy-1,6-diphenylhexan-2-yl)carbamate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl N-[(2S,4R,5R)-5-amino-4-hydroxy-1,6-diphenylhexan-2-yl]carbamate (CAS 1414933-89-3) is a chemical compound with the molecular formula C23H32N2O3 and a molecular weight of 384.5 g/mol. IUPAC name: tert-butyl N-[(2S,4R,5R)-5-amino-4-hydroxy-1,6-diphenylhexan-2-yl]carbamate. InChIKey: UKFHOTNATOJBKZ-PWRODBHTSA-N.
| Molecular formula | C23H32N2O3 |
|---|---|
| Molecular weight | 384.5 g/mol |
| IUPAC name | tert-butyl N-[(2S,4R,5R)-5-amino-4-hydroxy-1,6-diphenylhexan-2-yl]carbamate |
| InChIKey | UKFHOTNATOJBKZ-PWRODBHTSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC1=CC=CC=C1)C[C@H]([C@@H](CC2=CC=CC=C2)N)O |
Computed by PubChem (NCBI)