CAS 1971007-95-0 appears in our catalog under these names: MDMB-CHMICA (1mg/ml in Acetonitrile), MDMB-CHMICA, MDMB-CHMICA, 1mg/ml in Acetonitrile. Offered by: TRC, Lipomed. Available pack sizes: 1x1ml, 10mg, 1mg, 50mg, 100mg, 1ml.
Methyl (2S)-2-[[1-(cyclohexylmethyl)indole-3-carbonyl]amino]-3,3-dimethylbutanoate (CAS 1971007-95-0) is a chemical compound with the molecular formula C23H32N2O3 and a molecular weight of 384.5 g/mol. IUPAC name: methyl (2S)-2-[[1-(cyclohexylmethyl)indole-3-carbonyl]amino]-3,3-dimethylbutanoate. InChIKey: SRJKCVHWIDFUBO-HXUWFJFHSA-N.
| Molecular formula | C23H32N2O3 |
|---|---|
| Molecular weight | 384.5 g/mol |
| IUPAC name | methyl (2S)-2-[[1-(cyclohexylmethyl)indole-3-carbonyl]amino]-3,3-dimethylbutanoate |
| InChIKey | SRJKCVHWIDFUBO-HXUWFJFHSA-N |
| SMILES | CC(C)(C)[C@@H](C(=O)OC)NC(=O)C1=CN(C2=CC=CC=C21)CC3CCCCC3 |
Computed by PubChem (NCBI)