CAS 1414958-41-0 appears in our catalog under these names: tert-Butyl 3-(5-amino-1,3,4-oxadiazol-2-yl)pyrrolidine-1-carboxylate, 95%, tert-Butyl 3-(5-amino-1,3,4-oxadiazol-2-yl)pyrrolidine-1-carboxylate. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
Tert-butyl 3-(5-amino-1,3,4-oxadiazol-2-yl)pyrrolidine-1-carboxylate (CAS 1414958-41-0) is a chemical compound with the molecular formula C11H18N4O3 and a molecular weight of 254.29 g/mol. IUPAC name: tert-butyl 3-(5-amino-1,3,4-oxadiazol-2-yl)pyrrolidine-1-carboxylate. InChIKey: TYMIDAYCYHUCRZ-UHFFFAOYSA-N.
| Molecular formula | C11H18N4O3 |
|---|---|
| Molecular weight | 254.29 g/mol |
| IUPAC name | tert-butyl 3-(5-amino-1,3,4-oxadiazol-2-yl)pyrrolidine-1-carboxylate |
| InChIKey | TYMIDAYCYHUCRZ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(C1)C2=NN=C(O2)N |
Computed by PubChem (NCBI)