CAS 956198-86-0 is the registry number for N-(tert-Butyl)-2-(3,5-dimethyl-4-nitro-1H-pyrazol-1-yl)acetamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N-tert-butyl-2-(3,5-dimethyl-4-nitropyrazol-1-yl)acetamide (CAS 956198-86-0) is a chemical compound with the molecular formula C11H18N4O3 and a molecular weight of 254.29 g/mol. IUPAC name: N-tert-butyl-2-(3,5-dimethyl-4-nitropyrazol-1-yl)acetamide. InChIKey: IHBVZBKZEXXARF-UHFFFAOYSA-N.
| Molecular formula | C11H18N4O3 |
|---|---|
| Molecular weight | 254.29 g/mol |
| IUPAC name | N-tert-butyl-2-(3,5-dimethyl-4-nitropyrazol-1-yl)acetamide |
| InChIKey | IHBVZBKZEXXARF-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NN1CC(=O)NC(C)(C)C)C)[N+](=O)[O-] |
Computed by PubChem (NCBI)