CAS 1415329-20-2 appears in our catalog under these names: Ald-peg4-t-butyl ester, 95%, Ald–CH2–PEG4–Boc, Ald-PEG4-t-butyl ester, 96%, 96%, Ald-CH2-PEG4-Boc, 97.0%, tert-Butyl 1-oxo-3,6,9,12-tetraoxapentadecan-15-oate, 97%. Offered by: Combi-blocks, GLPBio, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 250mg, 1g, 100mg, 5g, 25g, 50 mg, 100 mg, 25 mg.
Tert-butyl 3-[2-[2-[2-(2-oxoethoxy)ethoxy]ethoxy]ethoxy]propanoate (CAS 1415329-20-2) is a chemical compound with the molecular formula C15H28O7 and a molecular weight of 320.38 g/mol. IUPAC name: tert-butyl 3-[2-[2-[2-(2-oxoethoxy)ethoxy]ethoxy]ethoxy]propanoate. InChIKey: SCAAICMVIUVGGM-UHFFFAOYSA-N.
| Molecular formula | C15H28O7 |
|---|---|
| Molecular weight | 320.38 g/mol |
| IUPAC name | tert-butyl 3-[2-[2-[2-(2-oxoethoxy)ethoxy]ethoxy]ethoxy]propanoate |
| InChIKey | SCAAICMVIUVGGM-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CCOCCOCCOCCOCC=O |
Computed by PubChem (NCBI)