Products 1423035-40-8
CAS 1423035-40-8 appears in our catalog under these names: Octyl-d-glucuronide methyl ester, 95%, Octyl D-glucuronide methyl ester. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 10g, 5g, 250mg, 2g, 25g.
Methyl (2S,3S,4S,5R)-3,4,5-trihydroxy-6-octoxyoxane-2-carboxylate (CAS 1423035-40-8) is a chemical compound with the molecular formula C15H28O7 and a molecular weight of 320.38 g/mol. IUPAC name: methyl (2S,3S,4S,5R)-3,4,5-trihydroxy-6-octoxyoxane-2-carboxylate. InChIKey: ACKBBJVQNULHIP-HXMBFPRCSA-N.
| Molecular formula | C15H28O7 |
|---|---|
| Molecular weight | 320.38 g/mol |
| IUPAC name | methyl (2S,3S,4S,5R)-3,4,5-trihydroxy-6-octoxyoxane-2-carboxylate |
| InChIKey | ACKBBJVQNULHIP-HXMBFPRCSA-N |
| SMILES | CCCCCCCCOC1[C@@H]([C@H]([C@@H]([C@H](O1)C(=O)OC)O)O)O |
Computed by PubChem (NCBI)