Products 1415566-33-4
CAS 1415566-33-4 is the registry number for (S)-3-Bromo-5-(pyrrolidin-2-yl)pyridine oxalate, 98%. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 10g, 100mg.
3-bromo-5-[(2S)-pyrrolidin-2-yl]pyridine;oxalic acid (CAS 1415566-33-4) is a chemical compound with the molecular formula C11H13BrN2O4 and a molecular weight of 317.14 g/mol. IUPAC name: 3-bromo-5-[(2S)-pyrrolidin-2-yl]pyridine;oxalic acid. InChIKey: JQAIBLZGPQVARZ-FVGYRXGTSA-N.
| Molecular formula | C11H13BrN2O4 |
|---|---|
| Molecular weight | 317.14 g/mol |
| IUPAC name | 3-bromo-5-[(2S)-pyrrolidin-2-yl]pyridine;oxalic acid |
| InChIKey | JQAIBLZGPQVARZ-FVGYRXGTSA-N |
| SMILES | C1C[C@H](NC1)C2=CC(=CN=C2)Br.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)