CAS 1457035-26-5 is the registry number for Ethyl 2-[(4-bromo-2-nitrophenyl)(methyl)amino]acetate, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
Ethyl 2-(4-bromo-N-methyl-2-nitroanilino)acetate (CAS 1457035-26-5) is a chemical compound with the molecular formula C11H13BrN2O4 and a molecular weight of 317.14 g/mol. IUPAC name: ethyl 2-(4-bromo-N-methyl-2-nitroanilino)acetate. InChIKey: FUUWMPKWHUBXOJ-UHFFFAOYSA-N.
| Molecular formula | C11H13BrN2O4 |
|---|---|
| Molecular weight | 317.14 g/mol |
| IUPAC name | ethyl 2-(4-bromo-N-methyl-2-nitroanilino)acetate |
| InChIKey | FUUWMPKWHUBXOJ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CN(C)C1=C(C=C(C=C1)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)