CAS 1415741-35-3 appears in our catalog under these names: rac-(3R,4R)-1-[(tert-butoxy)carbonyl]-3-methoxypiperidine-4-carboxylic acid, 97%, 97%, cis-1-(tert-Butoxycarbonyl)-3-methoxypiperidine-4-carboxylic acid, 97%. Offered by: Chemat, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
(3S,4S)-3-methoxy-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-4-carboxylic acid (CAS 1415741-35-3) is a chemical compound with the molecular formula C12H21NO5 and a molecular weight of 259.30 g/mol. IUPAC name: (3S,4S)-3-methoxy-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-4-carboxylic acid. InChIKey: JEBRCXVVNPFMDQ-DTWKUNHWSA-N.
| Molecular formula | C12H21NO5 |
|---|---|
| Molecular weight | 259.30 g/mol |
| IUPAC name | (3S,4S)-3-methoxy-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-4-carboxylic acid |
| InChIKey | JEBRCXVVNPFMDQ-DTWKUNHWSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC[C@@H]([C@@H](C1)OC)C(=O)O |
Computed by PubChem (NCBI)