Products 141577-40-4
CAS 141577-40-4 is the registry number for 2-NAP. Offered by: TRC, MedChemExpress. Available pack sizes: 100mg, Get quote.
(3S)-3-(naphthalen-2-ylsulfonylamino)-4-oxo-4-(2-phenylethylamino)butanoic acid (CAS 141577-40-4) is a chemical compound with the molecular formula C22H22N2O5S and a molecular weight of 426.5 g/mol. IUPAC name: (3S)-3-(naphthalen-2-ylsulfonylamino)-4-oxo-4-(2-phenylethylamino)butanoic acid. InChIKey: VMYREBYTVVSDDK-FQEVSTJZSA-N.
| Molecular formula | C22H22N2O5S |
|---|---|
| Molecular weight | 426.5 g/mol |
| IUPAC name | (3S)-3-(naphthalen-2-ylsulfonylamino)-4-oxo-4-(2-phenylethylamino)butanoic acid |
| InChIKey | VMYREBYTVVSDDK-FQEVSTJZSA-N |
| SMILES | C1=CC=C(C=C1)CCNC(=O)[C@H](CC(=O)O)NS(=O)(=O)C2=CC3=CC=CC=C3C=C2 |
Computed by PubChem (NCBI)