CAS 717857-38-0 is the registry number for 6-((4-(Indolin-1-ylsulfonyl)phenyl)carbamoyl)cyclohex-3-ene-1-carboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
6-[[4-(2,3-dihydroindol-1-ylsulfonyl)phenyl]carbamoyl]cyclohex-3-ene-1-carboxylic acid (CAS 717857-38-0) is a chemical compound with the molecular formula C22H22N2O5S and a molecular weight of 426.5 g/mol. IUPAC name: 6-[[4-(2,3-dihydroindol-1-ylsulfonyl)phenyl]carbamoyl]cyclohex-3-ene-1-carboxylic acid. InChIKey: STTHZJUMLUCUNG-UHFFFAOYSA-N.
| Molecular formula | C22H22N2O5S |
|---|---|
| Molecular weight | 426.5 g/mol |
| IUPAC name | 6-[[4-(2,3-dihydroindol-1-ylsulfonyl)phenyl]carbamoyl]cyclohex-3-ene-1-carboxylic acid |
| InChIKey | STTHZJUMLUCUNG-UHFFFAOYSA-N |
| SMILES | C1CN(C2=CC=CC=C21)S(=O)(=O)C3=CC=C(C=C3)NC(=O)C4CC=CCC4C(=O)O |
Computed by PubChem (NCBI)