Products 1415819-84-9
CAS 1415819-84-9 appears in our catalog under these names: 3-Methanesulfonyl-4-nitrobenzoic acid, 96%, 3-Methanesulfonyl-4-nitrobenzoic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 10g.
3-methylsulfonyl-4-nitrobenzoic acid (CAS 1415819-84-9) is a chemical compound with the molecular formula C8H7NO6S and a molecular weight of 245.21 g/mol. IUPAC name: 3-methylsulfonyl-4-nitrobenzoic acid. InChIKey: MXGMNAUBXXGJMP-UHFFFAOYSA-N.
| Molecular formula | C8H7NO6S |
|---|---|
| Molecular weight | 245.21 g/mol |
| IUPAC name | 3-methylsulfonyl-4-nitrobenzoic acid |
| InChIKey | MXGMNAUBXXGJMP-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=C(C=CC(=C1)C(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)