Products 858840-42-3
CAS 858840-42-3 is the registry number for 2,5-Dimethyl 3-nitrothiophene-2,5-dicarboxylate, 96%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
Dimethyl 3-nitrothiophene-2,5-dicarboxylate (CAS 858840-42-3) is a chemical compound with the molecular formula C8H7NO6S and a molecular weight of 245.21 g/mol. IUPAC name: dimethyl 3-nitrothiophene-2,5-dicarboxylate. InChIKey: YWBOQVIGDBXVPY-UHFFFAOYSA-N.
| Molecular formula | C8H7NO6S |
|---|---|
| Molecular weight | 245.21 g/mol |
| IUPAC name | dimethyl 3-nitrothiophene-2,5-dicarboxylate |
| InChIKey | YWBOQVIGDBXVPY-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(S1)C(=O)OC)[N+](=O)[O-] |
Computed by PubChem (NCBI)