CAS 1415819-92-9 is the registry number for 1-Bromo-5-fluoro-4-methanesulfonyl-2-nitrobenzene, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 25g, 1g, 5g.
1-bromo-5-fluoro-4-methylsulfonyl-2-nitrobenzene (CAS 1415819-92-9) is a chemical compound with the molecular formula C7H5BrFNO4S and a molecular weight of 298.09 g/mol. IUPAC name: 1-bromo-5-fluoro-4-methylsulfonyl-2-nitrobenzene. InChIKey: BGECMANMRHXGNN-UHFFFAOYSA-N.
| Molecular formula | C7H5BrFNO4S |
|---|---|
| Molecular weight | 298.09 g/mol |
| IUPAC name | 1-bromo-5-fluoro-4-methylsulfonyl-2-nitrobenzene |
| InChIKey | BGECMANMRHXGNN-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=C(C=C(C(=C1)[N+](=O)[O-])Br)F |
Computed by PubChem (NCBI)