CAS 1445995-73-2 appears in our catalog under these names: 3-Bromo-2-fluoro-5-nitrophenyl methyl sulphone, 95%, 1-Bromo-2-fluoro-3-(methylsulfonyl)-5-nitrobenzene, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
1-bromo-2-fluoro-3-methylsulfonyl-5-nitrobenzene (CAS 1445995-73-2) is a chemical compound with the molecular formula C7H5BrFNO4S and a molecular weight of 298.09 g/mol. IUPAC name: 1-bromo-2-fluoro-3-methylsulfonyl-5-nitrobenzene. InChIKey: MHVOFNPXNVSLCB-UHFFFAOYSA-N.
| Molecular formula | C7H5BrFNO4S |
|---|---|
| Molecular weight | 298.09 g/mol |
| IUPAC name | 1-bromo-2-fluoro-3-methylsulfonyl-5-nitrobenzene |
| InChIKey | MHVOFNPXNVSLCB-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=C(C(=CC(=C1)[N+](=O)[O-])Br)F |
Computed by PubChem (NCBI)