CAS 1415841-20-1 is the registry number for tert-Butyl 2-amino-5-oxo-5,6-dihydropyrido(3,4-d)pyrimidine-7(8H)-carboxylate, 97%. Offered by: AmBeed. Available pack sizes: 1g.
Tert-butyl 2-amino-5-oxo-6,8-dihydropyrido[3,4-d]pyrimidine-7-carboxylate (CAS 1415841-20-1) is a chemical compound with the molecular formula C12H16N4O3 and a molecular weight of 264.28 g/mol. IUPAC name: tert-butyl 2-amino-5-oxo-6,8-dihydropyrido[3,4-d]pyrimidine-7-carboxylate. InChIKey: BKYAQRZOEAGCDE-UHFFFAOYSA-N.
| Molecular formula | C12H16N4O3 |
|---|---|
| Molecular weight | 264.28 g/mol |
| IUPAC name | tert-butyl 2-amino-5-oxo-6,8-dihydropyrido[3,4-d]pyrimidine-7-carboxylate |
| InChIKey | BKYAQRZOEAGCDE-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2=NC(=NC=C2C(=O)C1)N |
Computed by PubChem (NCBI)