Products 2343964-10-1
CAS 2343964-10-1 is the registry number for (1R,2S,3R)-4-Amino-1-(2-phenyl-2H-1,2,3-triazol-4-yl)butane-1,2,3-triol. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
(1R,2S,3R)-4-amino-1-(2-phenyltriazol-4-yl)butane-1,2,3-triol (CAS 2343964-10-1) is a chemical compound with the molecular formula C12H16N4O3 and a molecular weight of 264.28 g/mol. IUPAC name: (1R,2S,3R)-4-amino-1-(2-phenyltriazol-4-yl)butane-1,2,3-triol. InChIKey: RFLWNLAGEPXFTL-UTUOFQBUSA-N.
| Molecular formula | C12H16N4O3 |
|---|---|
| Molecular weight | 264.28 g/mol |
| IUPAC name | (1R,2S,3R)-4-amino-1-(2-phenyltriazol-4-yl)butane-1,2,3-triol |
| InChIKey | RFLWNLAGEPXFTL-UTUOFQBUSA-N |
| SMILES | C1=CC=C(C=C1)N2N=CC(=N2)[C@H]([C@H]([C@@H](CN)O)O)O |
Computed by PubChem (NCBI)