CAS 1416052-89-5 is the registry number for Hericenone B. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 10mg.
5-[(2E)-3,7-dimethyl-5-oxoocta-2,6-dienyl]-4-hydroxy-6-methoxy-2-(2-phenylethyl)-3H-isoindol-1-one (CAS 1416052-89-5) is a chemical compound with the molecular formula C27H31NO4 and a molecular weight of 433.5 g/mol. IUPAC name: 5-[(2E)-3,7-dimethyl-5-oxoocta-2,6-dienyl]-4-hydroxy-6-methoxy-2-(2-phenylethyl)-3H-isoindol-1-one. InChIKey: AAXHHISTDMILPL-VXLYETTFSA-N.
| Molecular formula | C27H31NO4 |
|---|---|
| Molecular weight | 433.5 g/mol |
| IUPAC name | 5-[(2E)-3,7-dimethyl-5-oxoocta-2,6-dienyl]-4-hydroxy-6-methoxy-2-(2-phenylethyl)-3H-isoindol-1-one |
| InChIKey | AAXHHISTDMILPL-VXLYETTFSA-N |
| SMILES | CC(=CC(=O)C/C(=C/CC1=C(C=C2C(=C1O)CN(C2=O)CCC3=CC=CC=C3)OC)/C)C |
Computed by PubChem (NCBI)