Products 300362-80-5

CAS 300362-80-5 is the registry number for N-tert-Butoxycarbonyl-3,4-dibenzyloxyphenylethylamine. Offered by: TRC. Available pack sizes: 100mg, 250mg, 500mg.

Structural formula: {0} (CAS {1})

Tert-butyl N-[2-[3,4-bis(phenylmethoxy)phenyl]ethyl]carbamate (CAS 300362-80-5) is a chemical compound with the molecular formula C27H31NO4 and a molecular weight of 433.5 g/mol. IUPAC name: tert-butyl N-[2-[3,4-bis(phenylmethoxy)phenyl]ethyl]carbamate. InChIKey: PVALJZQCCRGZEC-UHFFFAOYSA-N.

Identity
Molecular formulaC27H31NO4
Molecular weight433.5 g/mol
IUPAC nametert-butyl N-[2-[3,4-bis(phenylmethoxy)phenyl]ethyl]carbamate
InChIKeyPVALJZQCCRGZEC-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)NCCC1=CC(=C(C=C1)OCC2=CC=CC=C2)OCC3=CC=CC=C3

Computed by PubChem (NCBI)