Products 1416439-55-8
CAS 1416439-55-8 appears in our catalog under these names: 5-Chloroquinoline-3-carboxylic acid, 95%, 5-Chloroquinoline-3-carboxylic acid 98%, 5-Chloroquinoline-3-carboxylic acid, 98%, 98%, 5-CHLOROQUINOLINE-3-CARBOXYLIC ACID, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg, 5g.
5-chloroquinoline-3-carboxylic acid (CAS 1416439-55-8) is a chemical compound with the molecular formula C10H6ClNO2 and a molecular weight of 207.61 g/mol. IUPAC name: 5-chloroquinoline-3-carboxylic acid. InChIKey: FRHNBZDXRJQHBZ-UHFFFAOYSA-N.
| Molecular formula | C10H6ClNO2 |
|---|---|
| Molecular weight | 207.61 g/mol |
| IUPAC name | 5-chloroquinoline-3-carboxylic acid |
| InChIKey | FRHNBZDXRJQHBZ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C(C=N2)C(=O)O)C(=C1)Cl |
Computed by PubChem (NCBI)