CAS 1416445-20-9 appears in our catalog under these names: (R)-(4-Benzyl-6,6-dimethylmorpholin-2-yl)methanol, 97%, (R)–(4–Benzyl–6,6–dimethylmorpholin–2–yl)methanol. Offered by: AmBeed, GLPBio. Available pack sizes: 5g, 100mg, 250mg.
[(2R)-4-benzyl-6,6-dimethylmorpholin-2-yl]methanol (CAS 1416445-20-9) is a chemical compound with the molecular formula C14H21NO2 and a molecular weight of 235.32 g/mol. IUPAC name: [(2R)-4-benzyl-6,6-dimethylmorpholin-2-yl]methanol. InChIKey: RKNCXMQRTZZKDM-CYBMUJFWSA-N.
| Molecular formula | C14H21NO2 |
|---|---|
| Molecular weight | 235.32 g/mol |
| IUPAC name | [(2R)-4-benzyl-6,6-dimethylmorpholin-2-yl]methanol |
| InChIKey | RKNCXMQRTZZKDM-CYBMUJFWSA-N |
| SMILES | CC1(CN(C[C@@H](O1)CO)CC2=CC=CC=C2)C |
Computed by PubChem (NCBI)