CAS 141650-31-9 appears in our catalog under these names: Atenolol EP Impurity E, Atenolol Impurity 5(Atenolol EP Impurity E), 4,4'-((2-Hydroxy-1,3-propanediyl)bis(oxy))bis-benzeneacetamide(Atenolol Impurity E), >95% (HPLC), 4,4'-((2-Hydroxy-1,3-propanediyl)bis(oxy))bis-benzeneacetamide (Atenolol Impurity E), >95% (HPLC), 2,2'-((2-Hydroxypropane-1,3-diyl)bis(oxy-4,1-phenylene))diacetamide. Offered by: Chemat Brand, Hubei YoungXin, TRC, Mikromol, Biosynth. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
2-[4-[3-[4-(2-amino-2-oxoethyl)phenoxy]-2-hydroxypropoxy]phenyl]acetamide (CAS 141650-31-9) is a chemical compound with the molecular formula C19H22N2O5 and a molecular weight of 358.4 g/mol. IUPAC name: 2-[4-[3-[4-(2-amino-2-oxoethyl)phenoxy]-2-hydroxypropoxy]phenyl]acetamide. InChIKey: RJTRBVLDVHIXNJ-UHFFFAOYSA-N.
| Molecular formula | C19H22N2O5 |
|---|---|
| Molecular weight | 358.4 g/mol |
| IUPAC name | 2-[4-[3-[4-(2-amino-2-oxoethyl)phenoxy]-2-hydroxypropoxy]phenyl]acetamide |
| InChIKey | RJTRBVLDVHIXNJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CC(=O)N)OCC(COC2=CC=C(C=C2)CC(=O)N)O |
Computed by PubChem (NCBI)