Products 2055114-62-8
CAS 2055114-62-8 is the registry number for Boc-beta-L-Aspartyl beta-naphthylamide, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-(naphthalen-2-ylamino)-4-oxobutanoic acid (CAS 2055114-62-8) is a chemical compound with the molecular formula C19H22N2O5 and a molecular weight of 358.4 g/mol. IUPAC name: (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-(naphthalen-2-ylamino)-4-oxobutanoic acid. InChIKey: QZWNWBSOJHEZNQ-HNNXBMFYSA-N.
| Molecular formula | C19H22N2O5 |
|---|---|
| Molecular weight | 358.4 g/mol |
| IUPAC name | (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-(naphthalen-2-ylamino)-4-oxobutanoic acid |
| InChIKey | QZWNWBSOJHEZNQ-HNNXBMFYSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC(=O)NC1=CC2=CC=CC=C2C=C1)C(=O)O |
Computed by PubChem (NCBI)