CAS 1416559-54-0 is the registry number for 2-Bromo-8-methylimidazo[2,1-a]isoquinoline, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-bromo-8-methylimidazo[2,1-a]isoquinoline (CAS 1416559-54-0) is a chemical compound with the molecular formula C12H9BrN2 and a molecular weight of 261.12 g/mol. IUPAC name: 2-bromo-8-methylimidazo[2,1-a]isoquinoline. InChIKey: YDPWEYDWAAOEDX-UHFFFAOYSA-N.
| Molecular formula | C12H9BrN2 |
|---|---|
| Molecular weight | 261.12 g/mol |
| IUPAC name | 2-bromo-8-methylimidazo[2,1-a]isoquinoline |
| InChIKey | YDPWEYDWAAOEDX-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)C3=NC(=CN3C=C2)Br |
Computed by PubChem (NCBI)