CAS 4103-29-1 is the registry number for 1-(2-Bromophenyl)-2-phenyldiazene 95%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g.
(2-bromophenyl)-phenyldiazene (CAS 4103-29-1) is a chemical compound with the molecular formula C12H9BrN2 and a molecular weight of 261.12 g/mol. IUPAC name: (2-bromophenyl)-phenyldiazene. InChIKey: MULAQBQFTFXRFO-UHFFFAOYSA-N.
| Molecular formula | C12H9BrN2 |
|---|---|
| Molecular weight | 261.12 g/mol |
| IUPAC name | (2-bromophenyl)-phenyldiazene |
| InChIKey | MULAQBQFTFXRFO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N=NC2=CC=CC=C2Br |
Computed by PubChem (NCBI)