CAS 1416711-53-9 appears in our catalog under these names: Butyl Paraben-13C6, >95% (HPLC), BUTYL 4-HYDROXYBENZOATE-(RING-13C6), Butylparaben-13C6, 99.75%. Offered by: TRC, Sigma-Aldrich, MedChemExpress. Available pack sizes: 0,5mg, 1mg, 2,5mg, 25MG, 1 mg, 500 μg.
Butyl 4-hydroxy(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene-1-carboxylate (CAS 1416711-53-9) is a chemical compound with the molecular formula C11H14O3 and a molecular weight of 200.18 g/mol. IUPAC name: butyl 4-hydroxy(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene-1-carboxylate. InChIKey: QFOHBWFCKVYLES-PXKSRZEUSA-N.
| Molecular formula | C11H14O3 |
|---|---|
| Molecular weight | 200.18 g/mol |
| IUPAC name | butyl 4-hydroxy(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene-1-carboxylate |
| InChIKey | QFOHBWFCKVYLES-PXKSRZEUSA-N |
| SMILES | CCCCOC(=O)[13C]1=[13CH][13CH]=[13C]([13CH]=[13CH]1)O |
Computed by PubChem (NCBI)