CAS 141695-86-5 is the registry number for 13-Hydroxynootkatone. Offered by: MedChemExpress. Available pack sizes: Get quote.
(4R,4aS,6R)-6-(3-hydroxyprop-1-en-2-yl)-4,4a-dimethyl-3,4,5,6,7,8-hexahydronaphthalen-2-one (CAS 141695-86-5) is a chemical compound with the molecular formula C15H22O2 and a molecular weight of 234.33 g/mol. IUPAC name: (4R,4aS,6R)-6-(3-hydroxyprop-1-en-2-yl)-4,4a-dimethyl-3,4,5,6,7,8-hexahydronaphthalen-2-one. InChIKey: AZDUDOOVVZKDCK-JMSVASOKSA-N.
| Molecular formula | C15H22O2 |
|---|---|
| Molecular weight | 234.33 g/mol |
| IUPAC name | (4R,4aS,6R)-6-(3-hydroxyprop-1-en-2-yl)-4,4a-dimethyl-3,4,5,6,7,8-hexahydronaphthalen-2-one |
| InChIKey | AZDUDOOVVZKDCK-JMSVASOKSA-N |
| SMILES | C[C@@H]1CC(=O)C=C2[C@]1(C[C@@H](CC2)C(=C)CO)C |
Computed by PubChem (NCBI)